ethane-1,2-diyl dithiophene-2-carboxylate
Chemical Structure Depiction of
ethane-1,2-diyl dithiophene-2-carboxylate
ethane-1,2-diyl dithiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8016-9859 |
| Compound Name: | ethane-1,2-diyl dithiophene-2-carboxylate |
| Molecular Weight: | 282.33 |
| Molecular Formula: | C12 H10 O4 S2 |
| Smiles: | C(COC(c1cccs1)=O)OC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0886 |
| logD: | 3.0886 |
| logSw: | -3.0716 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.099 |
| InChI Key: | GEPFSWBSEBWSQD-UHFFFAOYSA-N |