1-[(3-chlorophenyl)methyl]-3-nitropyridin-2(1H)-one
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-3-nitropyridin-2(1H)-one
1-[(3-chlorophenyl)methyl]-3-nitropyridin-2(1H)-one
Compound characteristics
| Compound ID: | 8017-0248 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-3-nitropyridin-2(1H)-one |
| Molecular Weight: | 264.67 |
| Molecular Formula: | C12 H9 Cl N2 O3 |
| Smiles: | C(c1cccc(c1)[Cl])N1C=CC=C(C1=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.3129 |
| logD: | 2.3129 |
| logSw: | -3.0398 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.061 |
| InChI Key: | XONHIUOTCAGQSE-UHFFFAOYSA-N |