3-[(dimethylamino)methylidene]-5-[(5-oxofuran-2(5H)-ylidene)methyl]furan-2(3H)-one
Chemical Structure Depiction of
3-[(dimethylamino)methylidene]-5-[(5-oxofuran-2(5H)-ylidene)methyl]furan-2(3H)-one
3-[(dimethylamino)methylidene]-5-[(5-oxofuran-2(5H)-ylidene)methyl]furan-2(3H)-one
Compound characteristics
| Compound ID: | 8017-1242 |
| Compound Name: | 3-[(dimethylamino)methylidene]-5-[(5-oxofuran-2(5H)-ylidene)methyl]furan-2(3H)-one |
| Molecular Weight: | 233.22 |
| Molecular Formula: | C12 H11 N O4 |
| Smiles: | CN(C)/C=C1/C=C(/C=C2/C=CC(=O)O2)OC1=O |
| Stereo: | ACHIRAL |
| logP: | 0.1494 |
| logD: | 0.1494 |
| logSw: | -0.0515 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.979 |
| InChI Key: | YURBPCHZFZUXLF-UHFFFAOYSA-N |