{6-bromo-5-methoxy-2-[(4-methoxyphenoxy)methyl]-1-methyl-1H-indol-3-yl}[4-(2-methylphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{6-bromo-5-methoxy-2-[(4-methoxyphenoxy)methyl]-1-methyl-1H-indol-3-yl}[4-(2-methylphenyl)piperazin-1-yl]methanone
{6-bromo-5-methoxy-2-[(4-methoxyphenoxy)methyl]-1-methyl-1H-indol-3-yl}[4-(2-methylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | 8017-1306 |
| Compound Name: | {6-bromo-5-methoxy-2-[(4-methoxyphenoxy)methyl]-1-methyl-1H-indol-3-yl}[4-(2-methylphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 578.51 |
| Molecular Formula: | C30 H32 Br N3 O4 |
| Smiles: | Cc1ccccc1N1CCN(CC1)C(c1c2cc(c(cc2n(C)c1COc1ccc(cc1)OC)[Br])OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8905 |
| logD: | 5.8905 |
| logSw: | -5.6018 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.04 |
| InChI Key: | LUBCJTVMAFTKOV-UHFFFAOYSA-N |