5-[(2-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione
Chemical Structure Depiction of
5-[(2-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione
5-[(2-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione
Compound characteristics
| Compound ID: | 8017-2103 |
| Compound Name: | 5-[(2-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione |
| Molecular Weight: | 381.42 |
| Molecular Formula: | C18 H18 F3 N3 O S |
| Smiles: | COc1ccccc1CN1CNC(N(C1)c1cccc(c1)C(F)(F)F)=S |
| Stereo: | ACHIRAL |
| logP: | 4.4311 |
| logD: | 4.0266 |
| logSw: | -4.3557 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.5628 |
| InChI Key: | LZIGGIMUKQRUPP-UHFFFAOYSA-N |