3-chloro-N-[1-(1-phenylethyl)-1H-benzimidazol-5-yl]-1-benzothiophene-2-carboxamide
					Chemical Structure Depiction of
3-chloro-N-[1-(1-phenylethyl)-1H-benzimidazol-5-yl]-1-benzothiophene-2-carboxamide
			3-chloro-N-[1-(1-phenylethyl)-1H-benzimidazol-5-yl]-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | 8017-3995 | 
| Compound Name: | 3-chloro-N-[1-(1-phenylethyl)-1H-benzimidazol-5-yl]-1-benzothiophene-2-carboxamide | 
| Molecular Weight: | 431.94 | 
| Molecular Formula: | C24 H18 Cl N3 O S | 
| Smiles: | CC(c1ccccc1)n1cnc2cc(ccc12)NC(c1c(c2ccccc2s1)[Cl])=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 6.314 | 
| logD: | 6.3137 | 
| logSw: | -6.4148 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 34.673 | 
| InChI Key: | JFIKFLBHVXGCIU-HNNXBMFYSA-N | 
 
				 
				