N-(4-fluorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide
N-(4-fluorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide
Compound characteristics
| Compound ID: | 8017-4136 |
| Compound Name: | N-(4-fluorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| Molecular Weight: | 289.3 |
| Molecular Formula: | C16 H16 F N O3 |
| Smiles: | CC1(C)C2CCC1(C(C2=O)=O)C(Nc1ccc(cc1)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.863 |
| logD: | 2.8372 |
| logSw: | -3.3244 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.467 |
| InChI Key: | LHXCYWIUALAIFS-UHFFFAOYSA-N |