ethyl {2-[4-(morpholine-4-sulfonyl)phenyl]ethyl}carbamate
Chemical Structure Depiction of
ethyl {2-[4-(morpholine-4-sulfonyl)phenyl]ethyl}carbamate
ethyl {2-[4-(morpholine-4-sulfonyl)phenyl]ethyl}carbamate
Compound characteristics
| Compound ID: | 8017-4298 |
| Compound Name: | ethyl {2-[4-(morpholine-4-sulfonyl)phenyl]ethyl}carbamate |
| Molecular Weight: | 342.41 |
| Molecular Formula: | C15 H22 N2 O5 S |
| Smiles: | CCOC(NCCc1ccc(cc1)S(N1CCOCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1019 |
| logD: | 1.1019 |
| logSw: | -2.4406 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.465 |
| InChI Key: | BQBKFYQGWGUGJY-UHFFFAOYSA-N |