2-butyl-9-(methoxymethyl)-3-{[(4-methoxyphenyl)methylidene]amino}-7-methylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
2-butyl-9-(methoxymethyl)-3-{[(4-methoxyphenyl)methylidene]amino}-7-methylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
2-butyl-9-(methoxymethyl)-3-{[(4-methoxyphenyl)methylidene]amino}-7-methylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | 8017-5652 |
| Compound Name: | 2-butyl-9-(methoxymethyl)-3-{[(4-methoxyphenyl)methylidene]amino}-7-methylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 450.56 |
| Molecular Formula: | C24 H26 N4 O3 S |
| Smiles: | CCCCC1=Nc2c3c(COC)cc(C)nc3sc2C(N1/N=C/c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0998 |
| logD: | 4.0992 |
| logSw: | -4.5013 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 59.135 |
| InChI Key: | OASSZEVBXSLMFG-UHFFFAOYSA-N |