3-[4-(1H-pyrrol-1-yl)phenyl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
3-[4-(1H-pyrrol-1-yl)phenyl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
3-[4-(1H-pyrrol-1-yl)phenyl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | 8017-5738 |
| Compound Name: | 3-[4-(1H-pyrrol-1-yl)phenyl]-N-[(thiophen-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 350.4 |
| Molecular Formula: | C18 H14 N4 O2 S |
| Smiles: | C(c1cccs1)NC(c1nc(c2ccc(cc2)n2cccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0466 |
| logD: | 4.0466 |
| logSw: | -4.3009 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.333 |
| InChI Key: | XTFPHDMKHSMBDL-UHFFFAOYSA-N |