3-({[2-(adamantan-1-yl)-1,3-thiazol-4-yl]methyl}sulfanyl)-5-[(4-chlorophenyl)methyl]-4-methyl-4H-1,2,4-triazole
Chemical Structure Depiction of
3-({[2-(adamantan-1-yl)-1,3-thiazol-4-yl]methyl}sulfanyl)-5-[(4-chlorophenyl)methyl]-4-methyl-4H-1,2,4-triazole
3-({[2-(adamantan-1-yl)-1,3-thiazol-4-yl]methyl}sulfanyl)-5-[(4-chlorophenyl)methyl]-4-methyl-4H-1,2,4-triazole
Compound characteristics
| Compound ID: | 8017-6387 |
| Compound Name: | 3-({[2-(adamantan-1-yl)-1,3-thiazol-4-yl]methyl}sulfanyl)-5-[(4-chlorophenyl)methyl]-4-methyl-4H-1,2,4-triazole |
| Molecular Weight: | 471.09 |
| Molecular Formula: | C24 H27 Cl N4 S2 |
| Smiles: | Cn1c(Cc2ccc(cc2)[Cl])nnc1SCc1csc(C23CC4CC(CC(C4)C3)C2)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.9124 |
| logD: | 6.9078 |
| logSw: | -6.7682 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.29 |
| InChI Key: | MMGMEUMJMFESOB-UHFFFAOYSA-N |