3-[5-methyl-2-(methylsulfanyl)thiophen-3-yl]-5-phenyl-4,5-dihydro-1,2-oxazole
Chemical Structure Depiction of
3-[5-methyl-2-(methylsulfanyl)thiophen-3-yl]-5-phenyl-4,5-dihydro-1,2-oxazole
3-[5-methyl-2-(methylsulfanyl)thiophen-3-yl]-5-phenyl-4,5-dihydro-1,2-oxazole
Compound characteristics
| Compound ID: | 8017-6844 |
| Compound Name: | 3-[5-methyl-2-(methylsulfanyl)thiophen-3-yl]-5-phenyl-4,5-dihydro-1,2-oxazole |
| Molecular Weight: | 289.42 |
| Molecular Formula: | C15 H15 N O S2 |
| Smiles: | Cc1cc(C2CC(c3ccccc3)ON=2)c(SC)s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9945 |
| logD: | 4.9945 |
| logSw: | -4.6963 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.5787 |
| InChI Key: | MNHDFAZCNVQPQD-CQSZACIVSA-N |