2-{[5-(5-methyl-1,2-oxazol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
					Chemical Structure Depiction of
2-{[5-(5-methyl-1,2-oxazol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
			2-{[5-(5-methyl-1,2-oxazol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | 8017-6858 | 
| Compound Name: | 2-{[5-(5-methyl-1,2-oxazol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide | 
| Molecular Weight: | 330.36 | 
| Molecular Formula: | C15 H14 N4 O3 S | 
| Smiles: | Cc1ccc(cc1)NC(CSc1nnc(c2cc(C)on2)o1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6394 | 
| logD: | 2.6394 | 
| logSw: | -3.051 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 74.442 | 
| InChI Key: | RYPUJBGHPKHSPK-UHFFFAOYSA-N | 
 
				 
				