N-[3-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide
Chemical Structure Depiction of
N-[3-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide
N-[3-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | 8017-7049 |
| Compound Name: | N-[3-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide |
| Molecular Weight: | 295.26 |
| Molecular Formula: | C14 H12 F3 N3 O |
| Smiles: | C1Cc2c(C(Nc3cccc(c3)C(F)(F)F)=O)n[nH]c2C1 |
| Stereo: | ACHIRAL |
| logP: | 3.3677 |
| logD: | 3.3591 |
| logSw: | -3.6797 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.649 |
| InChI Key: | GERQKPCPAJBLNB-UHFFFAOYSA-N |