3-[(4-chlorobenzene-1-sulfonyl)methyl]-N-[(furan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
3-[(4-chlorobenzene-1-sulfonyl)methyl]-N-[(furan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
3-[(4-chlorobenzene-1-sulfonyl)methyl]-N-[(furan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | 8017-7130 |
| Compound Name: | 3-[(4-chlorobenzene-1-sulfonyl)methyl]-N-[(furan-2-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 381.79 |
| Molecular Formula: | C15 H12 Cl N3 O5 S |
| Smiles: | C(c1ccco1)NC(c1nc(CS(c2ccc(cc2)[Cl])(=O)=O)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2809 |
| logD: | 2.2809 |
| logSw: | -3.2437 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 94.105 |
| InChI Key: | KEKNHCZZFCJQNX-UHFFFAOYSA-N |