methyl 5-amino-1-(2-methoxy-5-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
methyl 5-amino-1-(2-methoxy-5-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
methyl 5-amino-1-(2-methoxy-5-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | 8017-7331 |
| Compound Name: | methyl 5-amino-1-(2-methoxy-5-methylphenyl)-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 262.27 |
| Molecular Formula: | C12 H14 N4 O3 |
| Smiles: | Cc1ccc(c(c1)n1c(c(C(=O)OC)nn1)N)OC |
| Stereo: | ACHIRAL |
| logP: | 1.1361 |
| logD: | 1.1361 |
| logSw: | -1.9146 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.836 |
| InChI Key: | VEOIXLVCSXGZHR-UHFFFAOYSA-N |