2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluorophenyl)benzamide
Chemical Structure Depiction of
2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluorophenyl)benzamide
2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluorophenyl)benzamide
Compound characteristics
| Compound ID: | 8017-8758 |
| Compound Name: | 2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-fluorophenyl)benzamide |
| Molecular Weight: | 419.41 |
| Molecular Formula: | C23 H18 F N3 O4 |
| Smiles: | COc1ccc(cc1OC)c1nc(c2ccccc2C(Nc2ccc(cc2)F)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.4858 |
| logD: | 4.4844 |
| logSw: | -4.4225 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.996 |
| InChI Key: | RFKHHJXWYZZAAJ-UHFFFAOYSA-N |