3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid
3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | 8017-9362 |
| Compound Name: | 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid |
| Molecular Weight: | 249.22 |
| Molecular Formula: | C12 H11 N O5 |
| Smiles: | COc1cc2c(C=O)c(C(O)=O)[nH]c2cc1OC |
| Stereo: | ACHIRAL |
| logP: | 0.4729 |
| logD: | -3.3547 |
| logSw: | -1.3828 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.186 |
| InChI Key: | QVAZMCCSENVCPR-UHFFFAOYSA-N |