2-(decane-1-sulfonyl)ethyl carbamimidothioate--hydrogen bromide (1/1)
Chemical Structure Depiction of
2-(decane-1-sulfonyl)ethyl carbamimidothioate--hydrogen bromide (1/1)
2-(decane-1-sulfonyl)ethyl carbamimidothioate--hydrogen bromide (1/1)
Compound characteristics
| Compound ID: | 8017-9496 |
| Compound Name: | 2-(decane-1-sulfonyl)ethyl carbamimidothioate--hydrogen bromide (1/1) |
| Molecular Weight: | 389.42 |
| Molecular Formula: | C13 H28 N2 O2 S2 |
| Salt: | HBr |
| Smiles: | CCCCCCCCCCS(CCSC(N)=N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0996 |
| logD: | 2.4012 |
| logSw: | -3.1809 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 68.581 |
| InChI Key: | IUEVCQRWROZQCJ-UHFFFAOYSA-N |