N-(2-cyclohexyl-2-phenylethyl)naphthalene-2-sulfonamide
Chemical Structure Depiction of
N-(2-cyclohexyl-2-phenylethyl)naphthalene-2-sulfonamide
N-(2-cyclohexyl-2-phenylethyl)naphthalene-2-sulfonamide
Compound characteristics
| Compound ID: | 8018-0267 |
| Compound Name: | N-(2-cyclohexyl-2-phenylethyl)naphthalene-2-sulfonamide |
| Molecular Weight: | 393.55 |
| Molecular Formula: | C24 H27 N O2 S |
| Smiles: | C1CCC(CC1)C(CNS(c1ccc2ccccc2c1)(=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1444 |
| logD: | 6.1444 |
| logSw: | -6.9863 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.646 |
| InChI Key: | FDHKTRHMYYNWJY-XMMPIXPASA-N |