4-{[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]amino}-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-{[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]amino}-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide
4-{[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]amino}-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8018-1064 |
| Compound Name: | 4-{[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]amino}-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide |
| Molecular Weight: | 416.48 |
| Molecular Formula: | C18 H16 N4 O4 S2 |
| Smiles: | Cc1ccc(c2csc(Nc3ccc(cc3)S(Nc3cc(C)on3)(=O)=O)n2)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.5733 |
| logD: | 2.8023 |
| logSw: | -4.4401 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.463 |
| InChI Key: | BWSPXRDQMPDHJO-UHFFFAOYSA-N |