3-cyclopentyl-8-methyl-1,2,3,4,8,9-hexahydro-5H-pyrimido[5,4-e][1,3]thiazolo[3,2-a]pyrimidin-5-one
Chemical Structure Depiction of
3-cyclopentyl-8-methyl-1,2,3,4,8,9-hexahydro-5H-pyrimido[5,4-e][1,3]thiazolo[3,2-a]pyrimidin-5-one
3-cyclopentyl-8-methyl-1,2,3,4,8,9-hexahydro-5H-pyrimido[5,4-e][1,3]thiazolo[3,2-a]pyrimidin-5-one
Compound characteristics
| Compound ID: | 8018-1194 |
| Compound Name: | 3-cyclopentyl-8-methyl-1,2,3,4,8,9-hexahydro-5H-pyrimido[5,4-e][1,3]thiazolo[3,2-a]pyrimidin-5-one |
| Molecular Weight: | 292.4 |
| Molecular Formula: | C14 H20 N4 O S |
| Smiles: | CC1CN2C3=C(CN(CN3)C3CCCC3)C(N=C2S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6466 |
| logD: | 0.9291 |
| logSw: | -2.2541 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.812 |
| InChI Key: | JIUNBMDMOGELKC-VIFPVBQESA-N |