4-(4-bromophenyl)-6-(3,5-dimethylphenyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
Chemical Structure Depiction of
4-(4-bromophenyl)-6-(3,5-dimethylphenyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
4-(4-bromophenyl)-6-(3,5-dimethylphenyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
Compound characteristics
| Compound ID: | 8018-1506 |
| Compound Name: | 4-(4-bromophenyl)-6-(3,5-dimethylphenyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| Molecular Weight: | 426.31 |
| Molecular Formula: | C21 H20 Br N3 O2 |
| Smiles: | Cc1cc(C)cc(c1)N1CC2=C(C(c3ccc(cc3)[Br])NC(N2C)=O)C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2148 |
| logD: | 3.7284 |
| logSw: | -4.297 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.056 |
| InChI Key: | USXLDVVKDJUEKY-LJQANCHMSA-N |