phenyl P-methyl-N-(pyridin-2-yl)phosphonamidate
Chemical Structure Depiction of
phenyl P-methyl-N-(pyridin-2-yl)phosphonamidate
phenyl P-methyl-N-(pyridin-2-yl)phosphonamidate
Compound characteristics
| Compound ID: | 8018-1658 |
| Compound Name: | phenyl P-methyl-N-(pyridin-2-yl)phosphonamidate |
| Molecular Weight: | 248.22 |
| Molecular Formula: | C12 H13 N2 O2 P |
| Smiles: | CP(Nc1ccccn1)(=O)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 1.3137 |
| logD: | 1.3136 |
| logSw: | -1.4688 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.887 |
| InChI Key: | XYYOVFPAHCYHPS-QGZVFWFLSA-N |