2-chloro-3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-4,6-dimethylpyridine
Chemical Structure Depiction of
2-chloro-3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-4,6-dimethylpyridine
2-chloro-3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-4,6-dimethylpyridine
Compound characteristics
| Compound ID: | 8018-1842 |
| Compound Name: | 2-chloro-3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-4,6-dimethylpyridine |
| Molecular Weight: | 320.18 |
| Molecular Formula: | C15 H11 Cl2 N3 O |
| Smiles: | Cc1cc(C)nc(c1c1nc(c2ccccc2[Cl])on1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4537 |
| logD: | 4.4535 |
| logSw: | -4.8273 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.704 |
| InChI Key: | UAGBFIWGULXNEY-UHFFFAOYSA-N |