2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine-3-carbaldehyde
Chemical Structure Depiction of
2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine-3-carbaldehyde
2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine-3-carbaldehyde
Compound characteristics
| Compound ID: | 8018-2750 |
| Compound Name: | 2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine-3-carbaldehyde |
| Molecular Weight: | 241.22 |
| Molecular Formula: | C13 H8 F N3 O |
| Smiles: | C(c1c(c2ccc(cc2)F)nc2ncccn12)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9199 |
| logD: | 1.9199 |
| logSw: | -2.0049 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.24 |
| InChI Key: | LGRBLPULEFUFEN-UHFFFAOYSA-N |