6-[1,3-dimethyl-7-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydro-8H-imidazo[2,1-f]purin-8-yl]hexanehydrazide
Chemical Structure Depiction of
6-[1,3-dimethyl-7-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydro-8H-imidazo[2,1-f]purin-8-yl]hexanehydrazide
6-[1,3-dimethyl-7-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydro-8H-imidazo[2,1-f]purin-8-yl]hexanehydrazide
Compound characteristics
| Compound ID: | 8018-2806 |
| Compound Name: | 6-[1,3-dimethyl-7-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydro-8H-imidazo[2,1-f]purin-8-yl]hexanehydrazide |
| Molecular Weight: | 437.5 |
| Molecular Formula: | C22 H27 N7 O3 |
| Smiles: | Cc1ccc(cc1)C1=Cn2c3C(N(C)C(N(C)c3nc2N1CCCCCC(NN)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7411 |
| logD: | 1.7411 |
| logSw: | -2.2292 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 92.896 |
| InChI Key: | NYWNHDFHQLVCGA-UHFFFAOYSA-N |