[5-(3-chloro-4-fluorophenyl)furan-2-yl]methanol
Chemical Structure Depiction of
[5-(3-chloro-4-fluorophenyl)furan-2-yl]methanol
[5-(3-chloro-4-fluorophenyl)furan-2-yl]methanol
Compound characteristics
| Compound ID: | 8018-2957 |
| Compound Name: | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methanol |
| Molecular Weight: | 226.63 |
| Molecular Formula: | C11 H8 Cl F O2 |
| Smiles: | C(c1ccc(c2ccc(c(c2)[Cl])F)o1)O |
| Stereo: | ACHIRAL |
| logP: | 2.9396 |
| logD: | 2.9396 |
| logSw: | -3.1832 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.9234 |
| InChI Key: | DGTKDTLMWPVQOH-UHFFFAOYSA-N |