1-{4-[(2-methylphenyl)methoxy]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{4-[(2-methylphenyl)methoxy]phenyl}ethan-1-one
1-{4-[(2-methylphenyl)methoxy]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | 8018-3069 |
| Compound Name: | 1-{4-[(2-methylphenyl)methoxy]phenyl}ethan-1-one |
| Molecular Weight: | 240.3 |
| Molecular Formula: | C16 H16 O2 |
| Smiles: | CC(c1ccc(cc1)OCc1ccccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7267 |
| logD: | 3.7267 |
| logSw: | -3.9341 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 21.2927 |
| InChI Key: | KZVLLUQPERUMCL-UHFFFAOYSA-N |