N~1~-[(1,5-dimethyl-1H-pyrrol-2-yl)methyl]-N~2~-(4-methoxyphenyl)ethanediamide
					Chemical Structure Depiction of
N~1~-[(1,5-dimethyl-1H-pyrrol-2-yl)methyl]-N~2~-(4-methoxyphenyl)ethanediamide
			N~1~-[(1,5-dimethyl-1H-pyrrol-2-yl)methyl]-N~2~-(4-methoxyphenyl)ethanediamide
Compound characteristics
| Compound ID: | 8018-3101 | 
| Compound Name: | N~1~-[(1,5-dimethyl-1H-pyrrol-2-yl)methyl]-N~2~-(4-methoxyphenyl)ethanediamide | 
| Molecular Weight: | 301.34 | 
| Molecular Formula: | C16 H19 N3 O3 | 
| Smiles: | Cc1ccc(CNC(C(Nc2ccc(cc2)OC)=O)=O)n1C | 
| Stereo: | ACHIRAL | 
| logP: | 1.6327 | 
| logD: | 1.5366 | 
| logSw: | -2.0871 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 58.296 | 
| InChI Key: | KFSRSMZBNGQVMR-UHFFFAOYSA-N | 
 
				 
				