10-methyl-2,10-dihydro[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione
Chemical Structure Depiction of
10-methyl-2,10-dihydro[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione
10-methyl-2,10-dihydro[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione
Compound characteristics
| Compound ID: | 8018-3275 |
| Compound Name: | 10-methyl-2,10-dihydro[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione |
| Molecular Weight: | 216.2 |
| Molecular Formula: | C10 H8 N4 O2 |
| Smiles: | CN1C2=NNC(C(N2c2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.1179 |
| logD: | -0.2356 |
| logSw: | -1.6877 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.392 |
| InChI Key: | LXGOFPCSPUMAAI-UHFFFAOYSA-N |