[2-(benzylsulfanyl)phenyl]{1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl}methanone
Chemical Structure Depiction of
[2-(benzylsulfanyl)phenyl]{1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl}methanone
[2-(benzylsulfanyl)phenyl]{1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl}methanone
Compound characteristics
| Compound ID: | 8018-3464 |
| Compound Name: | [2-(benzylsulfanyl)phenyl]{1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl}methanone |
| Molecular Weight: | 569.72 |
| Molecular Formula: | C34 H35 N O5 S |
| Smiles: | COc1ccc(CC2c3cc(c(cc3CCN2C(c2ccccc2SCc2ccccc2)=O)OC)OC)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6425 |
| logD: | 5.6425 |
| logSw: | -5.4897 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 46.064 |
| InChI Key: | FSOKAQCGLMSBMD-NDEPHWFRSA-N |