4-(3-fluorophenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
Chemical Structure Depiction of
4-(3-fluorophenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
4-(3-fluorophenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
Compound characteristics
| Compound ID: | 8018-3568 |
| Compound Name: | 4-(3-fluorophenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| Molecular Weight: | 398.44 |
| Molecular Formula: | C24 H19 F N4 O |
| Smiles: | CC1=C(C(c2cccc(c2)F)n2c3ccccc3nc2N1)C(Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8253 |
| logD: | 4.8252 |
| logSw: | -4.6639 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.125 |
| InChI Key: | YBIDUUCWECDALA-QFIPXVFZSA-N |