2-{[5-(4-methoxyphenyl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)acetamide
Chemical Structure Depiction of
2-{[5-(4-methoxyphenyl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)acetamide
2-{[5-(4-methoxyphenyl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)acetamide
Compound characteristics
| Compound ID: | 8018-3788 |
| Compound Name: | 2-{[5-(4-methoxyphenyl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)acetamide |
| Molecular Weight: | 386.47 |
| Molecular Formula: | C18 H22 N6 O2 S |
| Smiles: | Cc1c(c(C)n(C)n1)NC(CSc1nnc(c2ccc(cc2)OC)n1C)=O |
| Stereo: | ACHIRAL |
| logP: | 1.111 |
| logD: | 1.1108 |
| logSw: | -2.1869 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.188 |
| InChI Key: | XIPTXPPUBLXJRF-UHFFFAOYSA-N |