{1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl}(4-methylphenyl)methanone
Chemical Structure Depiction of
{1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl}(4-methylphenyl)methanone
{1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl}(4-methylphenyl)methanone
Compound characteristics
| Compound ID: | 8018-3841 |
| Compound Name: | {1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl}(4-methylphenyl)methanone |
| Molecular Weight: | 420.3 |
| Molecular Formula: | C18 H11 F3 N4 O5 |
| Smiles: | Cc1ccc(cc1)C(c1nccn1c1c(cc(cc1[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8717 |
| logD: | 4.8717 |
| logSw: | -4.8678 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 91.233 |
| InChI Key: | JFPVQVFDIPIVBE-UHFFFAOYSA-N |