1-{4-[3-(morpholin-4-yl)-4-nitrophenyl]piperazin-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{4-[3-(morpholin-4-yl)-4-nitrophenyl]piperazin-1-yl}ethan-1-one
1-{4-[3-(morpholin-4-yl)-4-nitrophenyl]piperazin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | 8018-3972 |
| Compound Name: | 1-{4-[3-(morpholin-4-yl)-4-nitrophenyl]piperazin-1-yl}ethan-1-one |
| Molecular Weight: | 334.37 |
| Molecular Formula: | C16 H22 N4 O4 |
| Smiles: | CC(N1CCN(CC1)c1ccc(c(c1)N1CCOCC1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3625 |
| logD: | 1.3625 |
| logSw: | -2.0516 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 65.027 |
| InChI Key: | AWSKGSWXSSTLDD-UHFFFAOYSA-N |