2-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}-N-(3-methoxyphenyl)-2-oxoacetamide
Chemical Structure Depiction of
2-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}-N-(3-methoxyphenyl)-2-oxoacetamide
2-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}-N-(3-methoxyphenyl)-2-oxoacetamide
Compound characteristics
| Compound ID: | 8018-4070 |
| Compound Name: | 2-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}-N-(3-methoxyphenyl)-2-oxoacetamide |
| Molecular Weight: | 418.88 |
| Molecular Formula: | C24 H19 Cl N2 O3 |
| Smiles: | COc1cccc(c1)NC(C(c1cn(Cc2ccc(cc2)[Cl])c2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2831 |
| logD: | 5.2824 |
| logSw: | -5.8463 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.344 |
| InChI Key: | LIICTPYGXJJVPU-UHFFFAOYSA-N |