6-(3-fluorophenyl)-3-(thiophen-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
6-(3-fluorophenyl)-3-(thiophen-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
6-(3-fluorophenyl)-3-(thiophen-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | 8018-4451 |
| Compound Name: | 6-(3-fluorophenyl)-3-(thiophen-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 302.35 |
| Molecular Formula: | C13 H7 F N4 S2 |
| Smiles: | c1cc(cc(c1)F)c1nn2c(c3cccs3)nnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 3.5336 |
| logD: | 3.5336 |
| logSw: | -3.7008 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 34.74 |
| InChI Key: | KQFMEJCZBZSLCR-UHFFFAOYSA-N |