N-[(3-chlorophenyl)carbamoyl]-beta-alanine
Chemical Structure Depiction of
N-[(3-chlorophenyl)carbamoyl]-beta-alanine
N-[(3-chlorophenyl)carbamoyl]-beta-alanine
Compound characteristics
| Compound ID: | 8018-4726 |
| Compound Name: | N-[(3-chlorophenyl)carbamoyl]-beta-alanine |
| Molecular Weight: | 242.66 |
| Molecular Formula: | C10 H11 Cl N2 O3 |
| Smiles: | C(CNC(Nc1cccc(c1)[Cl])=O)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3444 |
| logD: | -1.3513 |
| logSw: | -2.3312 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.36 |
| InChI Key: | NPKDBJRQVVIXEV-UHFFFAOYSA-N |