1-(4-fluorophenyl)-3-(4-phenylpiperidin-1-yl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(4-fluorophenyl)-3-(4-phenylpiperidin-1-yl)pyrrolidine-2,5-dione
1-(4-fluorophenyl)-3-(4-phenylpiperidin-1-yl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8018-4985 |
| Compound Name: | 1-(4-fluorophenyl)-3-(4-phenylpiperidin-1-yl)pyrrolidine-2,5-dione |
| Molecular Weight: | 352.41 |
| Molecular Formula: | C21 H21 F N2 O2 |
| Smiles: | C1CN(CCC1c1ccccc1)C1CC(N(C1=O)c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9462 |
| logD: | 2.9461 |
| logSw: | -3.0053 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.716 |
| InChI Key: | NMRFSMZVJIUBAA-LJQANCHMSA-N |