3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoic acid
Chemical Structure Depiction of
3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoic acid
3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoic acid
Compound characteristics
| Compound ID: | 8018-5232 |
| Compound Name: | 3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoic acid |
| Molecular Weight: | 232.21 |
| Molecular Formula: | C13 H9 F O3 |
| Smiles: | C(=C/c1ccc(c2ccc(cc2)F)o1)\C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4525 |
| logD: | -0.6159 |
| logSw: | -3.326 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.192 |
| InChI Key: | LHPYNYVABBATBM-UHFFFAOYSA-N |