methyl 4-cyano-5-(2-hydroxybenzamido)-3-methylthiophene-2-carboxylate
Chemical Structure Depiction of
methyl 4-cyano-5-(2-hydroxybenzamido)-3-methylthiophene-2-carboxylate
methyl 4-cyano-5-(2-hydroxybenzamido)-3-methylthiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8018-5501 |
| Compound Name: | methyl 4-cyano-5-(2-hydroxybenzamido)-3-methylthiophene-2-carboxylate |
| Molecular Weight: | 316.33 |
| Molecular Formula: | C15 H12 N2 O4 S |
| Smiles: | Cc1c(C#N)c(NC(c2ccccc2O)=O)sc1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.9334 |
| logD: | -0.2375 |
| logSw: | -3.4103 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.902 |
| InChI Key: | LUDGAXWLBVFJJU-UHFFFAOYSA-N |