5-(4-fluorophenyl)-1,2-dimethyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
5-(4-fluorophenyl)-1,2-dimethyl-1H-pyrrole-3-carboxylic acid
5-(4-fluorophenyl)-1,2-dimethyl-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | 8018-5723 |
| Compound Name: | 5-(4-fluorophenyl)-1,2-dimethyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 233.24 |
| Molecular Formula: | C13 H12 F N O2 |
| Smiles: | Cc1c(cc(c2ccc(cc2)F)n1C)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9822 |
| logD: | -0.046 |
| logSw: | -3.1255 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.4075 |
| InChI Key: | OAKQOMKKKBNYCI-UHFFFAOYSA-N |