4,5-dimethoxy-N-[(pyridin-4-yl)methyl]-2-(1H-tetrazol-5-yl)aniline
Chemical Structure Depiction of
4,5-dimethoxy-N-[(pyridin-4-yl)methyl]-2-(1H-tetrazol-5-yl)aniline
4,5-dimethoxy-N-[(pyridin-4-yl)methyl]-2-(1H-tetrazol-5-yl)aniline
Compound characteristics
| Compound ID: | 8018-5837 |
| Compound Name: | 4,5-dimethoxy-N-[(pyridin-4-yl)methyl]-2-(1H-tetrazol-5-yl)aniline |
| Molecular Weight: | 312.33 |
| Molecular Formula: | C15 H16 N6 O2 |
| Smiles: | COc1cc(c(cc1OC)NCc1ccncc1)c1nnn[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 1.0045 |
| logD: | -1.7377 |
| logSw: | -1.7477 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.577 |
| InChI Key: | ULPXCJVHKHLCSI-UHFFFAOYSA-N |