4-bromo-N-(2-ethoxyphenyl)-3-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
4-bromo-N-(2-ethoxyphenyl)-3-methoxybenzene-1-sulfonamide
4-bromo-N-(2-ethoxyphenyl)-3-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8018-5868 |
| Compound Name: | 4-bromo-N-(2-ethoxyphenyl)-3-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 386.26 |
| Molecular Formula: | C15 H16 Br N O4 S |
| Smiles: | CCOc1ccccc1NS(c1ccc(c(c1)OC)[Br])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7285 |
| logD: | 3.4593 |
| logSw: | -3.9781 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.031 |
| InChI Key: | GOBAWAVDYSNSDD-UHFFFAOYSA-N |