4-methoxy-2,3-dimethyl-N-[(pyridin-4-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-methoxy-2,3-dimethyl-N-[(pyridin-4-yl)methyl]benzene-1-sulfonamide
4-methoxy-2,3-dimethyl-N-[(pyridin-4-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8018-5896 |
| Compound Name: | 4-methoxy-2,3-dimethyl-N-[(pyridin-4-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 306.38 |
| Molecular Formula: | C15 H18 N2 O3 S |
| Smiles: | Cc1c(ccc(c1C)S(NCc1ccncc1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.1934 |
| logD: | 2.1816 |
| logSw: | -2.4712 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.055 |
| InChI Key: | TUJZQXXZTSIAAK-UHFFFAOYSA-N |