4-{[(4-methoxyphenyl)methyl]amino}-3-methyl-4-oxobut-2-enoic acid
Chemical Structure Depiction of
4-{[(4-methoxyphenyl)methyl]amino}-3-methyl-4-oxobut-2-enoic acid
4-{[(4-methoxyphenyl)methyl]amino}-3-methyl-4-oxobut-2-enoic acid
Compound characteristics
| Compound ID: | 8018-6017 |
| Compound Name: | 4-{[(4-methoxyphenyl)methyl]amino}-3-methyl-4-oxobut-2-enoic acid |
| Molecular Weight: | 249.26 |
| Molecular Formula: | C13 H15 N O4 |
| Smiles: | C/C(=C/C(O)=O)C(NCc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1539 |
| logD: | -2.8684 |
| logSw: | -1.8309 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.851 |
| InChI Key: | QCVIKTDSXGOLKU-UHFFFAOYSA-N |