6,7-dimethoxy-1'-methyl-3,4-dihydrospiro[[2]benzopyran-1,4'-piperidine]--hydrogen chloride (1/1)
Chemical Structure Depiction of
6,7-dimethoxy-1'-methyl-3,4-dihydrospiro[[2]benzopyran-1,4'-piperidine]--hydrogen chloride (1/1)
6,7-dimethoxy-1'-methyl-3,4-dihydrospiro[[2]benzopyran-1,4'-piperidine]--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8018-6050 |
| Compound Name: | 6,7-dimethoxy-1'-methyl-3,4-dihydrospiro[[2]benzopyran-1,4'-piperidine]--hydrogen chloride (1/1) |
| Molecular Weight: | 313.82 |
| Molecular Formula: | C16 H23 N O3 |
| Salt: | HCl |
| Smiles: | CN1CCC2(CC1)c1cc(c(cc1CCO2)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 1.9858 |
| logD: | 0.0083 |
| logSw: | -2.2775 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.1141 |
| InChI Key: | BPEDKHLASBKSDU-UHFFFAOYSA-N |