1-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-2-(3-oxo-3,4-dihydroquinoxalin-1(2H)-yl)ethane-1,2-dione
Chemical Structure Depiction of
1-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-2-(3-oxo-3,4-dihydroquinoxalin-1(2H)-yl)ethane-1,2-dione
1-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-2-(3-oxo-3,4-dihydroquinoxalin-1(2H)-yl)ethane-1,2-dione
Compound characteristics
| Compound ID: | 8018-6725 |
| Compound Name: | 1-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-2-(3-oxo-3,4-dihydroquinoxalin-1(2H)-yl)ethane-1,2-dione |
| Molecular Weight: | 443.89 |
| Molecular Formula: | C25 H18 Cl N3 O3 |
| Smiles: | C1C(Nc2ccccc2N1C(C(c1cn(Cc2ccccc2[Cl])c2ccccc12)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4482 |
| logD: | 4.4475 |
| logSw: | -4.6058 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.856 |
| InChI Key: | IRLQRSMSTUWPDR-UHFFFAOYSA-N |