4-(pyridin-3-yl)-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
4-(pyridin-3-yl)-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazole-3-thiol
4-(pyridin-3-yl)-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazole-3-thiol
Compound characteristics
| Compound ID: | 8018-6913 |
| Compound Name: | 4-(pyridin-3-yl)-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 344.39 |
| Molecular Formula: | C16 H16 N4 O3 S |
| Smiles: | COc1cc(cc(c1OC)OC)c1nnc(n1c1cccnc1)S |
| Stereo: | ACHIRAL |
| logP: | 1.6954 |
| logD: | 0.4381 |
| logSw: | -1.2956 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.953 |
| InChI Key: | GNUMNUMASXUDKD-UHFFFAOYSA-N |